6-Methoxy-5-indanecarbaldehyde
Catalog No: FT-0630195
CAS No: 73615-83-5
- Chemical Name: 6-Methoxy-5-indanecarbaldehyde
- Molecular Formula: C11H12O2
- Molecular Weight: 176.21
- InChI Key: DWWCZKVBNWJJHC-UHFFFAOYSA-N
- InChI: InChI=1S/C11H12O2/c1-13-11-6-9-4-2-3-8(9)5-10(11)7-12/h5-7H,2-4H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | |
|---|---|
| FW: | 176.21200 |
| Density: | 1.142 g/cm3 |
| CAS: | 73615-83-5 |
| Bolling_Point: | 317.9ºC at 760 mmHg |
| Product_Name: | 6-Methoxyindan-5-carbaldehyde |
| Melting_Point: | N/A |
| Flash_Point: | N/A |
| MF: | C11H12O2 |
| Density: | 1.142 g/cm3 |
|---|---|
| LogP: | 1.99640 |
| Refractive_Index: | 1.587 |
| FW: | 176.21200 |
| PSA: | 26.30000 |
| MF: | C11H12O2 |
| Bolling_Point: | 317.9ºC at 760 mmHg |
| Exact_Mass: | 176.08400 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Warning_Statement: | P273 |
| Safety_Statements: | H411 |
| Symbol: | GHS09 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2912499000 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)